For research use only. Not for therapeutic Use.
DEAE-Cellulose (Cat No.: R004997) is a diethylaminoethyl cellulose derivative, essential for advanced biochemical and biotechnological research. This anion exchange resin is widely used for purifying proteins, nucleic acids, and other biomolecules. Its high binding capacity and selectivity make it ideal for ion-exchange chromatography applications. DEAE-Cellulose is highly valued for its efficiency and reliability, making it an indispensable tool in the development of biopharmaceuticals, diagnostic assays, and various research applications focused on molecular separation and purification processes.
CAS Number | 9013-34-7 |
Synonyms | Cellulose-DEAE, Diethylaminoethyl-cellulose |
Molecular Formula | C₂₀H₂₃NO₅ |
Purity | NA |
Documentation | |
IUPAC Name | (6S)-2-(hydroxymethyl)-6-[(3S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3?,4?,5?,6?,7?,8?,9?,10-,11?,12+/m1/s1 |
InChIKey | GUBGYTABKSRVRQ-WFVLMXAXSA-N |
SMILES | C(C1[C@H](C(C(C(O1)O)O)O)O[C@H]2C(C(C(C(O2)CO)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |