For research use only. Not for therapeutic Use.
Deacetylasperulosidic acid (Cat No.:M129688) is an iridoid glycoside primarily isolated from Morinda citrifolia (noni) and related medicinal plants. It has been widely studied for its antioxidant, anti-inflammatory, hepatoprotective, and anticancer properties. DAA is known to scavenge free radicals, suppress pro-inflammatory mediators, and protect tissues from oxidative damage. Research indicates its potential in modulating immune responses, inhibiting tumor growth, and preventing liver injury. Traditionally, noni-derived compounds like DAA have been used for wellness, and modern studies highlight its promise as a natural therapeutic agent in inflammation, oncology, and liver protection.
| CAS Number | 14259-55-3 |
| Synonyms | (1S,4aS,5S,7aS)-5-hydroxy-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
| Molecular Formula | C16H22O11 |
| Purity | ≥95% |
| IUPAC Name | (1S,4aS,5S,7aS)-5-hydroxy-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
| InChI | InChI=1S/C16H22O11/c17-2-5-1-7(19)10-6(14(23)24)4-25-15(9(5)10)27-16-13(22)12(21)11(20)8(3-18)26-16/h1,4,7-13,15-22H,2-3H2,(H,23,24)/t7-,8+,9+,10-,11+,12-,13+,15-,16-/m0/s1 |
| InChIKey | ZVXWFPTVHBWJOU-YYFGDFGFSA-N |
| SMILES | C1=C([C@@H]2[C@H]([C@H]1O)C(=CO[C@H]2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)O)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
