For research use only. Not for therapeutic Use.
DDR Inhibitor (Cat.No:I020140) is a compound that selectively targets and inhibits the DNA damage response (DDR) pathway. By disrupting DDR signaling, it can enhance the sensitivity of cancer cells to chemotherapy and radiation therapy. Further research is ongoing to evaluate its potential as an anticancer treatment.
| CAS Number | 1644069-80-6 |
| Molecular Formula | C₂₃H₂₀FN₅O₂ |
| Purity | ≥95% |
| Target | Discoidin Domain Receptor |
| IUPAC Name | N-[5-[[(3-fluorophenyl)carbamoylamino]methyl]-2-methylphenyl]imidazo[1,2-a]pyridine-3-carboxamide |
| InChI | InChI=1S/C23H20FN5O2/c1-15-8-9-16(13-26-23(31)27-18-6-4-5-17(24)12-18)11-19(15)28-22(30)20-14-25-21-7-2-3-10-29(20)21/h2-12,14H,13H2,1H3,(H,28,30)(H2,26,27,31) |
| InChIKey | ZPVUIOVIUFJGHO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CNC(=O)NC2=CC(=CC=C2)F)NC(=O)C3=CN=C4N3C=CC=C4 |
| Reference | [1]. Gordon Saxty, et al. Imidazo-condensed bicycles as inhibitors of discoidin domain receptors (ddrs) |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |