For research use only. Not for therapeutic Use.
DCE_254(Cat No.:I025604)is a synthetic compound primarily studied for its potential use in cancer treatment. It is a selective inhibitor of certain enzymes and signaling pathways that are involved in tumor growth and metastasis. DCE_254 has been shown to target specific molecular markers in cancer cells, potentially slowing down the progression of various cancers, including breast and prostate cancers. Its mechanism of action involves interfering with the cell cycle and promoting apoptosis (programmed cell death). Although promising, further clinical research and trials are needed to fully assess its therapeutic efficacy and safety.
| CAS Number | 673443-80-6 |
| Synonyms | DCE_254; DCE-254; DCE 254; DCE254; |
| Molecular Formula | C21H17N9OS |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-[(4-methylquinazolin-2-yl)amino]-4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1H-pyrimidin-6-one |
| InChI | InChI=1S/C21H17N9OS/c1-13-16-9-5-6-10-17(16)24-19(22-13)26-20-23-14(11-18(31)25-20)12-32-21-27-28-29-30(21)15-7-3-2-4-8-15/h2-11H,12H2,1H3,(H2,22,23,24,25,26,31) |
| InChIKey | BPNPOVCTXJWVNP-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC2=CC=CC=C12)NC3=NC(=CC(=O)N3)CSC4=NN=NN4C5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |