dBRD9 (Cat No.: I025588) is a small molecule that acts as a PROTAC (PROteolysis TArgeting Chimera) degrader. It is designed to target and degrade the BRD9 bromodomain protein by recruiting it to the cereblon E3 ubiquitin ligase complex. This mechanism of action leads to the ubiquitination and subsequent degradation of BRD9, resulting in the downregulation of its biological activity. dBRD9 and other PROTACs are being investigated as novel approaches for targeted protein degradation in drug discovery and development.
| Catalog Number | I025588 |
| CAS Number | 2170679-45-3 |
| Synonyms | dBRD-9; dBRD 9; dBRD9 |
| Molecular Formula | C40H45N7O10 |
| Purity | 98 |
| Solubility | Soluble in DMSO |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl-methylamino]-N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]acetamide |
| InChI | InChI=1S/C40H45N7O10/c1-45(21-29-32(54-3)18-24(19-33(29)55-4)28-22-46(2)38(51)27-20-41-11-10-25(27)28)23-35(49)43-13-15-57-17-16-56-14-12-42-30-7-5-6-26-36(30)40(53)47(39(26)52)31-8-9-34(48)44-37(31)50/h5-7,10-11,18-20,22,31,42H,8-9,12-17,21,23H2,1-4H3,(H,43,49)(H,44,48,50) |
| InChIKey | AIOCFZJGGGEWDK-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)C=NC=C2)C3=CC(=C(C(=C3)OC)CN(C)CC(=O)NCCOCCOCCNC4=CC=CC5=C4C(=O)N(C5=O)C6CCC(=O)NC6=O)OC |
