For research use only. Not for therapeutic Use.
DBCO-PEG2-acid（Cat No.:I016068）is a heterobifunctional linker containing a dibenzocyclooctyne (DBCO) moiety and a terminal carboxylic acid connected by a short PEG2 spacer. The DBCO group enables copper-free strain-promoted azide–alkyne cycloaddition (SPAAC), allowing fast, selective, and biocompatible conjugation with azides. The carboxylic acid provides a versatile functional handle for coupling with amines or alcohols through standard carbodiimide or esterification chemistry. The PEG2 spacer enhances solubility and imparts limited flexibility while minimizing steric hindrance. This reagent is widely applied in bioconjugation, drug delivery, surface modification, and chemical biology research.
| CAS Number | 2304558-25-4 |
| Synonyms | 3-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C26H28N2O6 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C26H28N2O6/c29-24(27-14-16-34-18-17-33-15-13-26(31)32)11-12-25(30)28-19-22-7-2-1-5-20(22)9-10-21-6-3-4-8-23(21)28/h1-8H,11-19H2,(H,27,29)(H,31,32) |
| InChIKey | IZLCAESRDHFGLF-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCC(=O)NCCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
