For research use only. Not for therapeutic Use.
DBCO-PEG1-acid（Cat No.:I016069）is a compact heterobifunctional linker featuring a dibenzocyclooctyne (DBCO) group and a terminal carboxylic acid connected by a short PEG1 spacer. The DBCO moiety undergoes copper-free strain-promoted azide–alkyne cycloaddition (SPAAC), enabling rapid, selective, and biocompatible conjugation with azides. The carboxylic acid serves as a versatile functional group for further coupling with primary amines or alcohols using carbodiimide or esterification chemistry. The short PEG1 chain provides minimal spacing, maintaining reactivity while improving solubility. This reagent is valuable for bioconjugation, surface modification, drug delivery, and chemical biology applications.
| CAS Number | 2228857-38-1 |
| Synonyms | 3-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]propanoic acid |
| Molecular Formula | C24H24N2O5 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]propanoic acid |
| InChI | InChI=1S/C24H24N2O5/c27-22(25-14-16-31-15-13-24(29)30)11-12-23(28)26-17-20-7-2-1-5-18(20)9-10-19-6-3-4-8-21(19)26/h1-8H,11-17H2,(H,25,27)(H,29,30) |
| InChIKey | WQWOQNUZPXTECB-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCC(=O)NCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
