For research use only. Not for therapeutic Use.
DB2313（Cat No.:I044368）is a synthetic aromatic diamidine compound designed to bind specifically to the minor groove of AT-rich DNA sequences. By targeting these sequences, DB2313 can interfere with DNA-protein interactions essential for gene expression, replication, and repair. It has demonstrated potent antimicrobial and anticancer activity by modulating transcriptional regulation and inhibiting the expression of key oncogenes or pathogenic factors. DB2313 is also used as a molecular probe for studying DNA structure and sequence recognition. Its high affinity and selectivity for AT-rich DNA make it a valuable tool in molecular biology and therapeutic research.
| CAS Number | 2170606-74-1 |
| Synonyms | 2-[4-[[2-fluoro-3-[[4-[6-(N’-propan-2-ylcarbamimidoyl)-1H-benzimidazol-2-yl]phenoxy]methyl]phenyl]methoxy]phenyl]-N’-propan-2-yl-3H-benzimidazole-5-carboximidamide |
| Molecular Formula | C42H41FN8O2 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[[2-fluoro-3-[[4-[6-(N'-propan-2-ylcarbamimidoyl)-1H-benzimidazol-2-yl]phenoxy]methyl]phenyl]methoxy]phenyl]-N'-propan-2-yl-3H-benzimidazole-5-carboximidamide |
| InChI | InChI=1S/C42H41FN8O2/c1-24(2)46-39(44)28-12-18-34-36(20-28)50-41(48-34)26-8-14-32(15-9-26)52-22-30-6-5-7-31(38(30)43)23-53-33-16-10-27(11-17-33)42-49-35-19-13-29(21-37(35)51-42)40(45)47-25(3)4/h5-21,24-25H,22-23H2,1-4H3,(H2,44,46)(H2,45,47)(H,48,50)(H,49,51) |
| InChIKey | NUVPJXUYFGWDGB-UHFFFAOYSA-N |
| SMILES | CC(C)N=C(C1=CC2=C(C=C1)N=C(N2)C3=CC=C(C=C3)OCC4=C(C(=CC=C4)COC5=CC=C(C=C5)C6=NC7=C(N6)C=C(C=C7)C(=NC(C)C)N)F)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
