For research use only. Not for therapeutic Use.
Dap-NE hydrochloride(CAT: I040443) is a cleavable dipeptide-based linker utilized in the synthesis of antibody-drug conjugates (ADCs). Composed of a Dap (2,3-diaminopropionic acid) residue and a cleavable NE (nucleophilic electrophile-sensitive) motif, this linker enables the stable attachment of cytotoxic payloads to antibodies, facilitating selective drug release within target cells. As a hydrochloride salt, it offers improved solubility and handling properties for conjugation workflows. Dap-NE hydrochloride is specifically designed for intracellular cleavage, making it ideal for targeted cancer therapy applications. It plays a critical role in ADC design, ensuring both efficient payload delivery and minimal systemic toxicity during therapeutic administration.
| CAS Number | 2019182-02-4 |
| Synonyms | (2R,3R)-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide;hydrochloride |
| Molecular Formula | C18H29ClN2O3 |
| Purity | ≥95% |
| IUPAC Name | (2R,3R)-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide;hydrochloride |
| InChI | InChI=1S/C18H28N2O3.ClH/c1-12(17(23-3)15-10-7-11-19-15)18(22)20-13(2)16(21)14-8-5-4-6-9-14;/h4-6,8-9,12-13,15-17,19,21H,7,10-11H2,1-3H3,(H,20,22);1H/t12-,13-,15+,16-,17-;/m1./s1 |
| InChIKey | SLLIOFGFGYMWNJ-FNCCNQCASA-N |
| SMILES | CC(C(C1CCCN1)OC)C(=O)NC(C)C(C2=CC=CC=C2)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
