For research use only. Not for therapeutic Use.
Dalmelitinib（Cat No.:I043412）is an investigational small molecule inhibitor targeting the Janus kinase (JAK) family, specifically JAK1 and JAK2. These kinases play a critical role in signaling pathways that regulate immune responses and cell proliferation. By inhibiting JAK activity, Dalmelitinib aims to modulate immune system function and reduce inflammation, making it a potential treatment for autoimmune disorders such as rheumatoid arthritis, as well as certain cancers. Currently undergoing clinical trials, Dalmelitinib holds promise as an effective therapy to manage diseases driven by overactive immune responses or abnormal cell growth. Further studies are ongoing to determine its safety and efficacy.
| CAS Number | 1637658-98-0 |
| Synonyms | 9-[[8-fluoro-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]-4-methyl-[1,4]oxazino[3,2-c]quinolin-3-one |
| Molecular Formula | C22H16FN7O2S |
| Purity | ≥95% |
| IUPAC Name | 9-[[8-fluoro-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]-4-methyl-[1,4]oxazino[3,2-c]quinolin-3-one |
| InChI | InChI=1S/C22H16FN7O2S/c1-28-9-13(7-25-28)12-5-16(23)21-26-27-22(30(21)10-12)33-14-3-4-17-15(6-14)20-18(8-24-17)29(2)19(31)11-32-20/h3-10H,11H2,1-2H3 |
| InChIKey | MFEXYTURXUZOID-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CN3C(=NN=C3SC4=CC5=C6C(=CN=C5C=C4)N(C(=O)CO6)C)C(=C2)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
