For research use only. Not for therapeutic Use.
Dacomitinib hydrate(Cat No.:I025502)is an orally administered, irreversible inhibitor of the epidermal growth factor receptor (EGFR) tyrosine kinase. It is used in the treatment of non-small cell lung cancer (NSCLC), particularly in patients with EGFR mutations. By blocking EGFR signaling, dacomitinib prevents cancer cell proliferation and survival, thereby inhibiting tumor growth. Dacomitinib hydrate is considered a second-generation EGFR inhibitor, offering improved efficacy compared to earlier treatments like gefitinib and erlotinib. Ongoing research aims to assess its potential in combination therapies and its effectiveness in various cancer types with EGFR mutations.
| CAS Number | 1042385-75-0 |
| Synonyms | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide;hydrate |
| Molecular Formula | C24H27ClFN5O3 |
| Purity | ≥95% |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide;hydrate |
| InChI | InChI=1S/C24H25ClFN5O2.H2O/c1-33-22-14-20-17(24(28-15-27-20)29-16-7-8-19(26)18(25)12-16)13-21(22)30-23(32)6-5-11-31-9-3-2-4-10-31;/h5-8,12-15H,2-4,9-11H2,1H3,(H,30,32)(H,27,28,29);1H2/b6-5+; |
| InChIKey | BSPLGGCPNTZPIH-IPZCTEOASA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)NC(=O)/C=C/CN4CCCCC4.O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |