For research use only. Not for therapeutic Use.
Dabigatran etexilate mesylate (Cat.No:I005256) is an oral anticoagulant medication used for the prevention of blood clots in conditions such as atrial fibrillation and deep vein thrombosis. It inhibits thrombin, an essential enzyme in the blood clotting process.
| CAS Number | 872728-81-9 |
| Synonyms | ethyl 3-(2-(((4-(N-((hexyloxy)carbonyl)carbamimidoyl)phenyl)amino)methyl)-1-methyl-N-(pyridin-2-yl)-1H-benzo[d]imidazole-5-carboxamido)propanoate methanesulfonate |
| Molecular Formula | C35H45N7O8S |
| Purity | ≥95% |
| Target | Thrombin |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 4.5 nM (Ki); 10 nM(Thrombin-induced platelet aggregation) [1] |
| IUPAC Name | ethyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;methanesulfonic acid |
| InChI | InChI=1S/C34H41N7O5.CH4O3S/c1-4-6-7-10-21-46-34(44)39-32(35)24-12-15-26(16-13-24)37-23-30-38-27-22-25(14-17-28(27)40(30)3)33(43)41(20-18-31(42)45-5-2)29-11-8-9-19-36-29;1-5(2,3)4/h8-9,11-17,19,22,37H,4-7,10,18,20-21,23H2,1-3H3,(H2,35,39,44);1H3,(H,2,3,4) |
| InChIKey | XETBXHPXHHOLOE-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)N=C(C1=CC=C(C=C1)NCC2=NC3=C(N2C)C=CC(=C3)C(=O)N(CCC(=O)OCC)C4=CC=CC=N4)N.CS(=O)(=O)O |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |