For research use only. Not for therapeutic Use.
D18（Cat No.:I044047）is a selective and potent small-molecule inhibitor of the histone methyltransferase G9a (EHMT2), an epigenetic enzyme responsible for mono- and dimethylation of histone H3 at lysine 9 (H3K9me1/2). By blocking G9a activity, D18 reduces repressive histone marks, leading to transcriptional reactivation of silenced genes involved in differentiation, tumor suppression, and development. It is particularly valuable in cancer, neurodevelopmental, and stem cell research, where epigenetic regulation is a key factor. D18 supports investigations into chromatin remodeling, gene expression control, and therapeutic strategies targeting aberrant epigenetic states in disease.
| CAS Number | 2230218-36-5 |
| Synonyms | 4-N-butyl-6-[[4-[(dimethylamino)methyl]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine |
| Molecular Formula | C21H28N6 |
| Purity | ≥95% |
| IUPAC Name | 4-N-butyl-6-[[4-[(dimethylamino)methyl]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine |
| InChI | InChI=1S/C21H28N6/c1-4-5-12-23-20-19-18(25-21(22)26-20)11-10-17(24-19)13-15-6-8-16(9-7-15)14-27(2)3/h6-11H,4-5,12-14H2,1-3H3,(H3,22,23,25,26) |
| InChIKey | DUCCCPVHDPRCEB-UHFFFAOYSA-N |
| SMILES | CCCCNC1=NC(=NC2=C1N=C(C=C2)CC3=CC=C(C=C3)CN(C)C)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
