For research use only. Not for therapeutic Use.
D-Tagatose(Cat No.:R052936), is a natural monosaccharide and a low-calorie sugar substitute. It is structurally similar to D-fructose but is poorly absorbed in the human digestive system, resulting in its low caloric value. D-Tagatose is approximately 90% as sweet as sucrose (table sugar) and is often used as a sugar substitute in various food and beverage products. Its reduced caloric content and minimal impact on blood sugar levels make it suitable for individuals with diabetes or those seeking to reduce their calorie intake while enjoying sweet-tasting foods and drinks.
| CAS Number | 87-81-0 |
| Synonyms | D-lyxo-2-Hexulose; |
| Molecular Formula | C6H12O6 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | (3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6-/m1/s1 |
| InChIKey | BJHIKXHVCXFQLS-PQLUHFTBSA-N |
| SMILES | C(C(C(C(C(=O)CO)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |