For research use only. Not for therapeutic Use.
D-Ribose (Cat No.: R000408) is a naturally occurring five-carbon monosaccharide (a pentose sugar) with an aldopentose structure. It plays a crucial role in biology as the sugar backbone of ribonucleotides, which are the building blocks of RNA. D-Ribose is also found in important biomolecules such as ATP, NAD⁺, and FAD, essential for cellular energy transfer and metabolism. It exists in both open-chain and cyclic (furanose) forms and is widely used in biochemistry, nutritional supplements, and research related to nucleic acid metabolism.
| CAS Number | 50-69-1 |
| Synonyms | Ribose; D-(-)-Ribose; |
| Molecular Formula | C5H10O5 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Store at -20C |
| IUPAC Name | (2R,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m0/s1 |
| InChIKey | PYMYPHUHKUWMLA-LMVFSUKVSA-N |
| SMILES | C(C(C(C(C=O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
