D-Proline, 4-hydroxy-, methyl ester, hydrochloride (1:1), (4R)- - CAS 114676-59-4
D-Proline, 4-hydroxy-, methyl ester, hydrochloride (Cat.No:M018300) is a chemical compound used in organic synthesis. It belongs to the class of proline derivatives and has potential applications in pharmaceutical and fine chemical industries. Its chiral nature and unique structure contribute to its utility in creating diverse molecules with specific properties.
Catalog Number: M018300
CAS Number: 114676-59-4
PubChem Substance ID:355158835
Molecular Formula: C6H12ClNO3
Molecular Weight:181.616
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
| Molecular Formula: | C6H12ClNO3 |
|---|---|
| Molecular Weight | 181.616 |
| Purity | ≥95% |
| Storage | Store at RT |
Computed Descriptor
| IUPAC Name | methyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| InChI | InChI=1S/C6H11NO3.ClH/c1-10-6(9)5-2-4(8)3-7-5;/h4-5,7-8H,2-3H2,1H3;1H/t4-,5-;/m1./s1 |
| InChIKey | KLGSHNXEUZOKHH-TYSVMGFPSA-N |
| SMILES | COC(=O)C1CC(CN1)O.Cl |