For research use only. Not for therapeutic Use.
D-Phenylalanine (Cat No.: A000565) is the D-isomer of the essential amino acid phenylalanine and is used primarily for its potential analgesic and mood-enhancing effects. Unlike the L-form, it is not incorporated into proteins but may inhibit the enzymes enkephalinase and endorphinase, thereby prolonging the action of endorphins and enkephalins—natural painkillers and mood regulators. D-Phenylalanine is sometimes used as a dietary supplement for chronic pain and mood support. It is generally well-tolerated, though high doses may cause headaches or gastrointestinal discomfort.
| CAS Number | 673-06-3 |
| Synonyms | NA |
| Molecular Formula | C9H11NO2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | 3 years -20C powder |
| IUPAC Name | (2R)-2-amino-3-phenylpropanoic acid |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1 |
| InChIKey | COLNVLDHVKWLRT-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
