D-Neopterin（Cat No.:R011809）, is a biochemically significant molecule. It is a naturally occurring pteridine derivative primarily found in human and mammalian bodily fluids, serving as a marker for immune system activity. Elevated levels of D-Neopterin are often associated with immune system activation, particularly in response to infections, inflammatory conditions, and autoimmune diseases. Medical professionals use its measurement in clinical settings to assess immune system function and diagnose various disorders. D-Neopterin’s role as a diagnostic marker highlights its importance in monitoring and understanding the body’s immune response, aiding in the early detection and management of relevant medical conditions.
| Catalog Number | R011809 |
| CAS Number | 2009-64-5 |
| Synonyms | 2-Amino-6-[(1S,2R)-1,2,3-trihydroxypropyl]-4(3H)-pteridinone; Neopterin; 2-Amino-4-hydroxy-6-(1,2,3-trihydroxypropyl)pteridine; 2-Amino-6-((1S,2R)-1,2,3-trihydroxypropyl)-4(8H)-pteridone; 6-D-erythro-Neopterin; ?D-(+)-Neopterin; D-erythro-Neopterin; |
| Molecular Formula | C9H11N5O4 |
| Purity | 95% |
| Storage | 2-8°C |
| IUPAC Name | 2-amino-6-[(1S,2R)-1,2,3-trihydroxypropyl]-1H-pteridin-4-one |
| InChI | InChI=1S/C9H11N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h1,4,6,15-17H,2H2,(H3,10,11,13,14,18)/t4-,6+/m1/s1 |
| InChIKey | BMQYVXCPAOLZOK-XINAWCOVSA-N |
| SMILES | C1=C(N=C2C(=N1)NC(=NC2=O)N)C(C(CO)O)O |
