For research use only. Not for therapeutic Use.
D-Neopterin-¹³C₅ is a carbon-13 labeled version of D-neopterin, a pteridine derivative that serves as a biomarker for immune system activation, particularly in conditions involving cellular immunity. The five carbon-13 isotopes provide a distinct signature for precise tracking in metabolic and immunological studies. D-Neopterin-¹³C₅ is used extensively in research to monitor immune response, particularly in diseases like cancer, viral infections, and autoimmune disorders. Its applications are significant in pharmaceutical research, biochemistry, and clinical diagnostics, where it aids in understanding immune processes and developing therapeutic strategies.
| CAS Number | 1217632-04-6 |
| Synonyms | 2-Amino-6-[(1S,2R)-1,2,3-trihydroxypropyl]-4(3H)-pteridinone-13C5; Neopterin-13C5; 2-Amino-4-hydroxy-6-(1,2,3-trihydroxypropyl)pteridine-13C5; 2-Amino-6-((1S,2R)-1,2,3-trihydroxypropyl)-4(8H)-pteridone-13C5; 6-D-erythro-Neopterin-13C5; D-(+)-Neopteri |
| Molecular Formula | C9H11N5O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-amino-6-[(1S,2R)-1,2,3-trihydroxypropyl]-1H-pteridin-4-one |
| InChI | InChI=1S/C9H11N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h1,4,6,15-17H,2H2,(H3,10,11,13,14,18)/t4-,6+/m1/s1/i1+1,2+1,3+1,4+1,6+1 |
| InChIKey | BMQYVXCPAOLZOK-NNFFBITRSA-N |
| SMILES | [13CH]1=[13C](N=C2C(=O)NC(=NC2=N1)N)[13C@@H]([13C@@H]([13CH2]O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |