D-Glucose-13C6(Cat No.:M009831) is a labeled form of glucose where all six carbon atoms are isotopically enriched with carbon-13 (13C), a stable isotope of carbon. This specialized version of glucose is used primarily in scientific research to trace metabolic pathways and understand biochemical processes through techniques such as nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. By following the 13C label through various metabolic transformations, researchers can gain insights into how glucose is utilized by cells, how it contributes to energy production, and its role in disease mechanisms, particularly in conditions like diabetes.
Catalog Number | M009831 |
CAS Number | 110187-42-3 |
Synonyms | 2,3,4,5,6-Pentakis(oxidanyl)hexanal; 2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexanal |
Molecular Formula | C6H12O6 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexanal |
InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/i1+1,2+1,3+1,4+1,5+1,6+1 |
InChIKey | GZCGUPFRVQAUEE-IDEBNGHGSA-N |
SMILES | C(C(C(C(C(C=O)O)O)O)O)O |