For research use only. Not for therapeutic Use.
D-Fructose 2,6-diphosphate sodium salt(Cat No.:M002104) is a salt form of fructose 2,6-bisphosphate (F2,6BP), a crucial metabolic regulator that plays a significant role in glucose homeostasis. This compound acts as an allosteric activator of phosphofructokinase-1 and an inhibitor of fructose-1,6-bisphosphatase, influencing key steps in glycolysis and gluconeogenesis. By binding and modifying the activity of these enzymes, it helps regulate the rate of glucose breakdown and synthesis, responding to cellular energy needs. The sodium salt form enhances solubility and stability, making it suitable for research and potential therapeutic applications involving energy metabolism disorders.
| CAS Number | 84364-89-6 |
| Synonyms | D-FRUCTOSE 2,6-DIPHOSPHATE SODIUM SALT;D-Fructose 2,6-bisphosphate sodium salt;SodiuM ((2S,3S,4S,5R)-3,4-dihydroxy-2-(phosphonooxy)-5-((phosphonooxy)Methyl)tetrahydrofuran-2-yl)Methanolate |
| Molecular Formula | C6H13NaO12P2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | sodium;[(2S,3S,4S,5R)-3,4-dihydroxy-2-phosphonooxy-5-(phosphonooxymethyl)oxolan-2-yl]methanolate |
| InChI | InChI=1S/C6H13O12P2.Na/c7-2-6(18-20(13,14)15)5(9)4(8)3(17-6)1-16-19(10,11)12;/h3-5,8-9H,1-2H2,(H2,10,11,12)(H2,13,14,15);/q-1;+1/t3-,4-,5+,6+;/m1./s1 |
| InChIKey | UAGLXYBMOWLLDI-QAYODLCCSA-N |
| SMILES | C(C1C(C(C(O1)(C[O-])OP(=O)(O)O)O)O)OP(=O)(O)O.[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |