For research use only. Not for therapeutic Use.
D-erythro-MAPP (Cat No.:R043497) is a potent, irreversible inhibitor of glucosylceramide synthase (GCS), the enzyme responsible for the first step in glycosphingolipid biosynthesis. By blocking GCS activity, D-erythro-MAPP reduces the production of glucosylceramide and downstream glycosphingolipids, making it a valuable research tool in studying lipid metabolism and lysosomal storage disorders such as Gaucher and Fabry diseases. It is also used to explore therapeutic approaches for cancer and neurodegenerative conditions where altered glycosphingolipid levels contribute to disease mechanisms. D-erythro-MAPP enables detailed investigation into glycosylation and membrane biology.
| CAS Number | 143492-38-0 |
| Synonyms | N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]tetradecanamide |
| Molecular Formula | C23H39NO2 |
| Purity | ≥95% |
| IUPAC Name | N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]tetradecanamide |
| InChI | InChI=1S/C23H39NO2/c1-3-4-5-6-7-8-9-10-11-12-16-19-22(25)24-20(2)23(26)21-17-14-13-15-18-21/h13-15,17-18,20,23,26H,3-12,16,19H2,1-2H3,(H,24,25)/t20-,23-/m1/s1 |
| InChIKey | YLAZEWZHIRBZDA-NFBKMPQASA-N |
| SMILES | CCCCCCCCCCCCCC(=O)N[C@H](C)[C@H](C1=CC=CC=C1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |