For research use only. Not for therapeutic Use.
D-Digitoxose (Cat No.: R054491) is a deoxy sugar with the molecular formula C₆H₁₂O₄, structurally related to D-glucose but lacking a hydroxyl group at the C-2 position. It is commonly found as a sugar moiety in cardiac glycosides such as digitoxin, where it contributes to the compound’s pharmacokinetics and biological activity. D-Digitoxose plays a crucial role in modulating the solubility, membrane permeability, and receptor interactions of glycoside molecules. It is also used in research involving glycosylation and structure–activity relationship (SAR) studies in medicinal chemistry.
CAS Number | 527-52-6 |
Synonyms | 2,6-Dideoxy-D-ribo-hexose; Digitoxose; (+)-Digitoxose; 2,6-Dideoxy-D-altrose; NSC 87513; |
Molecular Formula | C₆H₁₂O₄ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (4S,5S,6R)-6-methyloxane-2,4,5-triol |
InChI | InChI=1S/C6H12O4/c1-3-6(9)4(7)2-5(8)10-3/h3-9H,2H2,1H3/t3-,4+,5?,6-/m1/s |
InChIKey | FDWRIIDFYSUTDP-WGDKFINWSA-N |
SMILES | C[C@@H]1[C@H]([C@H](CC(O1)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |