For research use only. Not for therapeutic Use.
D-Aspartic acid（Cat No.:R051849）is the D-enantiomer of the amino acid aspartic acid, naturally occurring in the human body, particularly in the brain, endocrine glands, and reproductive organs. It plays a regulatory role in hormone production, notably stimulating the release of luteinizing hormone (LH) and testosterone, making it of interest in fertility and athletic performance research. D-Aspartic acid is also involved in neurotransmission and neuroendocrine signaling. Unlike its L-form, which is used in protein synthesis, the D-form functions in biochemical regulation. It is commonly used as a dietary supplement to support hormonal health.
| CAS Number | 1783-96-6 |
| Synonyms | (-)-Aspartic Acid; (R)-Aspartic Acid; D-(-)-Aspartic Acid; 2-Aminobutanedioic Acid; NSC 97922 |
| Molecular Formula | C4H7NO4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | Store at +4C |
| IUPAC Name | (2R)-2-aminobutanedioic acid |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1 |
| InChIKey | CKLJMWTZIZZHCS-UWTATZPHSA-N |
| SMILES | C([C@H](C(=O)O)N)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
