For research use only. Not for therapeutic Use.
D-Arabinose（Cat No.:M063480）is a naturally occurring pentose sugar belonging to the aldopentose family, structurally related to D-ribose but differing in configuration. It is widely found in bacterial polysaccharides, plant cell walls, and glycoproteins. D-Arabinose plays a key role as a building block in the biosynthesis of arabinans, arabinogalactans, and mycobacterial cell wall components, making it significant in infectious disease research. Beyond structural functions, it serves as a biochemical reagent in carbohydrate metabolism studies. Its versatile applications highlight its importance in microbiology, glycobiology, and biomedical research.
| CAS Number | 10323-20-3 |
| Synonyms | (2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| Molecular Formula | C5H10O5 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4-,5+/m1/s1 |
| InChIKey | PYMYPHUHKUWMLA-WDCZJNDASA-N |
| SMILES | C([C@H]([C@H]([C@@H](C=O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
