For research use only. Not for therapeutic Use.
D-Alanine-d7(Cat No.:S000627) is a deuterium-labeled variant of the D-isomer of alanine, where all seven hydrogen atoms are replaced with deuterium (D), the heavier isotope of hydrogen. This heavy labeling significantly improves the detection and analysis of alanine in scientific studies using mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. D-Alanine-d7 is particularly valuable in research focusing on the metabolic pathways and enzymatic reactions involving D-alanine, such as bacterial cell wall synthesis. The deuterium labeling provides precise tracking and detailed insights into the specific roles and behaviors of D-alanine in various biological systems.
CAS Number | 2483831-62-3 |
Molecular Formula | C3D7NO2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | deuterio (2R)-2,3,3,3-tetradeuterio-2-(dideuterioamino)propanoate |
InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m1/s1/i1D3,2D/hD3 |
InChIKey | QNAYBMKLOCPYGJ-VETUMQINSA-N |
SMILES | CC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |