For research use only. Not for therapeutic Use.
D-(–)-2-Phenylglycine(CAT: R016511) is a chiral, non-proteinogenic amino acid featuring a phenyl group attached to the α-carbon of glycine in the D-configuration. It is widely used as a building block in asymmetric synthesis, pharmaceutical development, and peptidomimetic design. Its enantiopurity and rigid structure make it valuable for producing chirally pure APIs, particularly in β-lactam antibiotics and enzyme inhibitors. D-Phenylglycine is also employed in stereochemical studies, ligand design, and chiral resolution methods. Its incorporation into peptides or small molecules can modulate bioactivity, metabolic stability, and receptor selectivity, making it a key intermediate in medicinal and synthetic organic chemistry.
| CAS Number | 875-74-1 |
| Synonyms | (-)-(R)-Phenylglycine; (-)-Phenylglycine; (2R)-Amino-2-phenylethanoic Acid; (R)-(-)-2-Phenylglycine; (R)-2-Amino-2-phenylacetic Acid; (R)-2-Amino-2-phenylethanoic Acid; (R)-2-Phenyl-2-aminoethanoic Acid; (R)-2-Phenylglycine; (R)-2-Phenylglycine; (R)- |
| Molecular Formula | C8H9NO2 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | (2R)-2-amino-2-phenylacetic acid |
| InChI | InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | ZGUNAGUHMKGQNY-SSDOTTSWSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |