For research use only. Not for therapeutic Use.
Cytochalasin E (Cat No.: R027630) is a natural compound derived from the Cytochalasin family of metabolites. It acts as an inhibitor of actin polymerization, disrupting the dynamics of the actin cytoskeleton. By binding to actin filaments, Cytochalasin E prevents the formation of new actin filaments and impairs cellular processes like cell division, migration, and intracellular trafficking. Due to its effects on the cytoskeleton, it is studied for its potential in cancer research, cell biology, and understanding cellular mechanics in various diseases.
| CAS Number | 36011-19-5 |
| Synonyms | (7S,13E,16S,18R,19E)-6,7-Epoxy-18-hydroxy-16,18-dimethyl-10-phenyl-21,23-Dioxa[13]cytochalasa-13,19-diene-1,17,22-trione; Cytochalasin E; NSC 175151;?[4S-(1E,4R*,6S*,7E,11aR*,14R*,14aR*,15R*,15aS*,16aR*,16bR*)]-3,13,14,14a,15,15a,16a,16b-Octahydro-6- |
| Molecular Formula | C28H33NO7 |
| Purity | ≥95% |
| Target | Autophagy |
| Storage | -20°C |
| IUPAC Name | (1S,5E,7R,9S,11E,13S,14S,16R,17S,18S,19S)-19-benzyl-7-hydroxy-7,9,16,17-tetramethyl-2,4,15-trioxa-20-azatetracyclo[11.8.0.01,18.014,16]henicosa-5,11-diene-3,8,21-trione |
| InChI | InChI=1S/C28H33NO7/c1-16-9-8-12-19-23-27(4,35-23)17(2)21-20(15-18-10-6-5-7-11-18)29-24(31)28(19,21)36-25(32)34-14-13-26(3,33)22(16)30/h5-8,10-14,16-17,19-21,23,33H,9,15H2,1-4H3,(H,29,31)/b12-8+,14-13+/t16-,17-,19-,20-,21-,23-,26+,27+,28+/m0/s1 |
| InChIKey | LAJXCUNOQSHRJO-ZYGJITOWSA-N |
| SMILES | CC1CC=CC2C3C(O3)(C(C4C2(C(=O)NC4CC5=CC=CC=C5)OC(=O)OC=CC(C1=O)(C)O)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |