For research use only. Not for therapeutic Use.
Cytidine-5′-triphosphate (Cat No.:I044351) is a pyrimidine nucleoside triphosphate that plays a vital role in numerous cellular processes. As a building block of RNA, CTP participates in transcription by serving as a substrate for RNA polymerases. Beyond nucleic acid synthesis, it is essential in lipid metabolism, acting as a co-substrate in the formation of phospholipids like phosphatidylcholine and phosphatidylethanolamine. CTP also plays a regulatory role in nucleotide biosynthesis by influencing enzymatic activity within the pyrimidine salvage pathway. Its multifunctionality makes it crucial for cell proliferation, membrane formation, and energy transfer.
| CAS Number | 65-47-4 |
| Synonyms | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| Molecular Formula | C9H16N3O14P3 |
| Purity | ≥95% |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChI | InChI=1S/C9H16N3O14P3/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | PCDQPRRSZKQHHS-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
