For research use only. Not for therapeutic Use.
Cytidine 5′-diphosphoethanolamine (Cat No.:I043986) is a crucial intermediate in the biosynthesis of phosphatidylethanolamine, a major component of cellular membranes. It plays a key role in the production of phospholipids by donating the ethanolamine headgroup to diacylglycerol, facilitating the formation of phosphatidylethanolamine in cells. CDP-ethanolamine is involved in essential cellular processes, including membrane biogenesis, signal transduction, and lipid metabolism. It is of significant interest in biochemical research related to membrane dynamics, lipidomics, and metabolic diseases. Its ability to influence lipid composition makes it valuable for exploring cellular function and dysfunction.
| CAS Number | 3036-18-8 |
| Synonyms | [2-aminoethoxy(hydroxy)phosphoryl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| Molecular Formula | C11H20N4O11P2 |
| Purity | ≥95% |
| IUPAC Name | [2-aminoethoxy(hydroxy)phosphoryl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| InChI | InChI=1S/C11H20N4O11P2/c12-2-4-23-27(19,20)26-28(21,22)24-5-6-8(16)9(17)10(25-6)15-3-1-7(13)14-11(15)18/h1,3,6,8-10,16-17H,2,4-5,12H2,(H,19,20)(H,21,22)(H2,13,14,18)/t6-,8-,9-,10-/m1/s1 |
| InChIKey | WVIMUEUQJFPNDK-PEBGCTIMSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)OCCN)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
