For research use only. Not for therapeutic Use.
Cypermethrin (Cat No.: R007084) is a synthetic pyrethroid insecticide widely used in agriculture, public health, and household pest control. It acts by disrupting the sodium channels in the nervous system of insects, causing paralysis and death. Known for its rapid knockdown effect and broad-spectrum activity, cypermethrin is effective against various pests, including flies, mosquitoes, ants, and agricultural insects. Although considered low in toxicity to humans and mammals, it is highly toxic to aquatic life and bees, necessitating careful application and environmental management practices.
| CAS Number | 52315-07-8 |
| Synonyms | 3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropanecarboxylic Acid Cyano(3-phenoxyphenyl)methyl Ester; NRDC-149; FMC-30980; PP-383; Ammo; Arrivo; Barricade; Basathrin; Cymbush; Demon; Flectron; Ripcord; |
| Molecular Formula | C22H19Cl2NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChI | InChI=1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3 |
| InChIKey | KAATUXNTWXVJKI-UHFFFAOYSA-N |
| SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |