For research use only. Not for therapeutic Use.
Cyclopropyl methyl ketone (Cat No.: R021336)is an aliphatic ketone characterized by a three-membered cyclopropyl ring attached to a methyl ketone group. It is a colorless, flammable liquid with a sharp odor and the chemical formula C₅H₈O. This compound is used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals, agrochemicals, and fine chemicals. Its strained ring structure and reactive carbonyl group make it a versatile building block in constructing more complex molecules through reactions like nucleophilic addition and condensation.
| CAS Number | 765-43-5 |
| Synonyms | 1-Cyclopropylethanone; Acetylcyclopropane; Cyclopropyl Methyl Ketone; Cyclopropylethanone; Methyl Cyclopropyl Ketone; NSC 1940 |
| Molecular Formula | C5H8O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-cyclopropylethanone |
| InChI | InChI=1S/C5H8O/c1-4(6)5-2-3-5/h5H,2-3H2,1H3 |
| InChIKey | HVCFCNAITDHQFX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CC1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
