Home
>
Chemical Reagents>Organic Building Blocks>
>
Cyclopropanecarboxylic acid, 1-(4-nitrophenyl)-, methyl ester
Cyclopropanecarboxylic acid, 1-(4-nitrophenyl)-, methyl ester (Cat.No:L003705) is a noteworthy chemical compound widely employed in organic synthesis. Its structure, featuring a nitrophenyl group, imparts distinct reactivity and properties. This compound serves as a key intermediate in the production of specialized organic molecules with various industrial and pharmaceutical applications.
Catalog Number | L003705 |
CAS Number | 23348-98-3 |
Molecular Formula | C11H11NO4 |
Purity | 95% |
IUPAC Name | methyl 1-(4-nitrophenyl)cyclopropane-1-carboxylate |
InChI | InChI=1S/C11H11NO4/c1-16-10(13)11(6-7-11)8-2-4-9(5-3-8)12(14)15/h2-5H,6-7H2,1H3 |
InChIKey | WZBRUNXCRWCZBL-UHFFFAOYSA-N |
SMILES | COC(=O)C1(CC1)C2=CC=C(C=C2)[N+](=O)[O-] |