For research use only. Not for therapeutic Use.
Cyclopentane-1,1-dicarboxylic acid(CAT: L046810) is a specialized cyclic dicarboxylic acid useful in various fields of chemical and pharmaceutical research. Known for its stability and structural uniqueness, this compound is commonly employed in the synthesis of novel organic frameworks and as a building block in drug design. Its rigid cyclopentane backbone with dual carboxylic acid functional groups allows it to play a significant role in the development of pharmaceuticals and biochemical studies. Cyclopentane-1,1-dicarboxylic acid serves as a versatile intermediate in the synthesis of compounds with potential therapeutic properties, particularly for studies in medicinal chemistry and pharmacology.
| CAS Number | 5802-65-3 |
| Molecular Formula | C7H10O4 |
| Purity | ≥95% |
| IUPAC Name | cyclopentane-1,1-dicarboxylic acid |
| InChI | InChI=1S/C7H10O4/c8-5(9)7(6(10)11)3-1-2-4-7/h1-4H2,(H,8,9)(H,10,11) |
| InChIKey | YZFOGXKZTWZVFN-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |