For research use only. Not for therapeutic Use.
Cyclo(Ile-Ala)（Cat No.:I044805）is a cyclic dipeptide, also known as a diketopiperazine (DKP), composed of the amino acids isoleucine and alanine. Naturally occurring in various microorganisms and fermented foods, it is valued for its structural stability and biological activities. Cyclo(Ile-Ala) has been studied for antimicrobial, antioxidant, and anticancer properties, often attributed to its ability to interact with cellular targets and disrupt biological pathways. Its compact, cyclic structure enhances resistance to enzymatic degradation, making it a useful scaffold in drug development. This peptide is also explored in chemical ecology and signaling research.
| CAS Number | 90821-99-1 |
| Synonyms | 3-butan-2-yl-6-methylpiperazine-2,5-dione |
| Molecular Formula | C9H16N2O2 |
| Purity | ≥95% |
| IUPAC Name | 3-butan-2-yl-6-methylpiperazine-2,5-dione |
| InChI | InChI=1S/C9H16N2O2/c1-4-5(2)7-9(13)10-6(3)8(12)11-7/h5-7H,4H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | JDRIJDPCYNFZIT-UHFFFAOYSA-N |
| SMILES | CCC(C)C1C(=O)NC(C(=O)N1)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
