For research use only. Not for therapeutic Use.
(Cyclohexanecarbonyl)-L-leucine(Cat No.:I043013)is a modified amino acid derivative where the amino group of L-leucine is protected by a cyclohexanecarbonyl (Chc) group. This protection prevents unwanted reactions during peptide synthesis, particularly in solid-phase peptide synthesis (SPPS). The cyclohexanecarbonyl group is a bulky, hydrophobic moiety that enhances the stability of the peptide during synthesis. This compound is commonly used in the design of peptides for drug development and research, as it can influence peptide folding, hydrophobic interactions, and bioactivity. The Chc group is also valuable in studies of protein-ligand interactions.
| CAS Number | 157116-68-2 |
| Synonyms | (2S)-2-(cyclohexanecarbonylamino)-4-methylpentanoic acid |
| Molecular Formula | C13H23NO3 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(cyclohexanecarbonylamino)-4-methylpentanoic acid |
| InChI | InChI=1S/C13H23NO3/c1-9(2)8-11(13(16)17)14-12(15)10-6-4-3-5-7-10/h9-11H,3-8H2,1-2H3,(H,14,15)(H,16,17)/t11-/m0/s1 |
| InChIKey | MJOSQGRPLTUAHR-NSHDSACASA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)C1CCCCC1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |