For research use only. Not for therapeutic Use.
Cyclo(L-prolyl-L-phenylalanyl)(Cat No.:R036298)is a cyclic dipeptide composed of proline and phenylalanine, forming a stable structure due to the peptide bond between the amino acids. This compound is of interest in pharmaceutical research for its potential biological activity, particularly in the context of protein-protein interactions and as a building block in drug design. Cyclo(L-prolyl-L-phenylalanyl) has been explored for its role in modulating enzyme activity, with implications in targeting specific receptors and pathways related to various therapeutic areas. Its stability and unique properties make it valuable in peptide-based drug development.
| CAS Number | 3705-26-8 |
| Synonyms | (3S,8aS)-3-Benzylhexahydro-pyrrolo[1,2-a]pyrazine-1,4-dione; (3S-trans)-Hexahydro-3-(phenylmethyl)-pyrrolo[1,2-a]pyrazine-1,4-dione; (3S,8aS)-Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione; Cyclo(L-Phe-L-Pro); Cyclo(L-Pro-L-Phe); Cyclo(L- |
| Molecular Formula | C14H16N2O2 |
| Purity | 95% |
| Appearance | White solid |
| Storage | Store at RT |
| Analysis method | HPLC |
| IUPAC Name | (3S,8aS)-3-benzyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChI | InChI=1S/C14H16N2O2/c17-13-12-7-4-8-16(12)14(18)11(15-13)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,15,17)/t11-,12-/m0/s1 |
| InChIKey | QZBUWPVZSXDWSB-RYUDHWBXSA-N |
| SMILES | C1C[C@H]2C(=O)N[C@H](C(=O)N2C1)CC3=CC=CC=C3 |
| Reference | Citromycetins and bilains A-C: new aromatic polyketides and diketopiperazines from Australian marinederived and terrestrial Penicillium spp. Capon R.J. et al. J. Nat. Prod. 2007, 70, 1746.<br /> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |