For research use only. Not for therapeutic Use.
CY3-N3 (Cat.No:I013798) is a chemical compound with potential applications in biological imaging and labeling. It is a fluorescent dye derivative containing an azide group, making it suitable for bioorthogonal click chemistry reactions. CY3-N3 enables the specific and sensitive detection of biomolecules, facilitating studies in cellular and molecular biology.
| CAS Number | 1621101-43-6 |
| Molecular Formula | C₃₆H₄₆N₆O₇S₂ |
| Purity | ≥95% |
| Target | DNA Stain |
| Solubility | 10 mM in DMSO; H2O: < 7.4 mg/mL |
| IUPAC Name | (2E)-2-[(2E,4E)-5-[1-[6-(3-azidopropylamino)-6-oxohexyl]-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate |
| InChI | InChI=1S/C36H46N6O7S2/c1-6-41-30-19-17-26(50(44,45)46)24-28(30)35(2,3)32(41)14-9-7-10-15-33-36(4,5)29-25-27(51(47,48)49)18-20-31(29)42(33)23-12-8-11-16-34(43)38-21-13-22-39-40-37/h7,9-10,14-15,17-20,24-25H,6,8,11-13,16,21-23H2,1-5H3,(H2-,38,43,44,45,46,47,48,49) |
| InChIKey | LSISYTNZXRYXJU-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)S(=O)(=O)[O-])C(C1=CC=CC=CC3=[N+](C4=C(C3(C)C)C=C(C=C4)S(=O)(=O)O)CCCCCC(=O)NCCCN=[N+]=[N-])(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |