For research use only. Not for therapeutic Use.
Cucurbitacin IIb(CAT: R072484) is a natural triterpenoid compound found in plants belonging to the Cucurbitaceae family, such as bitter melon (Momordica charantia) and cucumbers. Its mode of action involves various biological activities, including anti-inflammatory, anticancer, and immunomodulatory effects. Pharmacologically, cucurbitacin IIb has been studied for its potential therapeutic applications in cancer treatment, particularly in inhibiting cell proliferation and inducing apoptosis in cancer cells. It also exhibits anti-inflammatory properties by modulating certain signaling pathways involved in the inflammatory response.
CAS Number | 50298-90-3 |
Molecular Formula | C30H48O7 |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | (2S,3S,8S,9R,10R,13R,14S,16R,17R)-17-[(2R)-2,6-dihydroxy-6-methyl-3-oxoheptan-2-yl]-2,3,16-trihydroxy-4,4,9,13,14-pentamethyl-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one |
InChI | InChI=1S/C30H48O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,17-20,23-24,31-32,35-37H,10-15H2,1-8H3/t17-,18+,19-,20+,23+,24-,27+,28-,29+,30+/m1/s1 |
InChIKey | VVBWBGOEAVGFTN-LPQIEKFGSA-N |
SMILES | CC1(C(C(CC2C1=CCC3C2(C(=O)CC4(C3(CC(C4C(C)(C(=O)CCC(C)(C)O)O)O)C)C)C)O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |