For research use only. Not for therapeutic Use.
CTx-0294885(Cat No.:I001696)is a potent and selective inhibitor of bromodomain-containing protein 4 (BRD4), a member of the BET family involved in regulating gene expression. By targeting BRD4, CTx-0294885 disrupts the transcription of genes essential for cancer cell growth and survival, making it a promising candidate for cancer therapy. This compound has shown potential in preclinical studies to inhibit tumor growth, particularly in cancers with dysregulated BRD4 activity. Its targeted mechanism offers hope for developing new, more effective treatments for various malignancies, highlighting its importance in oncology research.
| CAS Number | 1439934-41-4 |
| Synonyms | 2-[[5-chloro-2-[[4-(1-piperazinyl)phenyl]amino]-4-pyrimidinyl]amino]-N-methyl-benzamide |
| Molecular Formula | C₂₂H₂₄ClN₇O |
| Purity | ≥95% |
| Target | Akt |
| Solubility | DMSO: ≥ 41 mg/mL |
| Storage | -20°C |
| IUPAC Name | 2-[[5-chloro-2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-N-methylbenzamide |
| InChI | InChI=1S/C22H24ClN7O/c1-24-21(31)17-4-2-3-5-19(17)28-20-18(23)14-26-22(29-20)27-15-6-8-16(9-7-15)30-12-10-25-11-13-30/h2-9,14,25H,10-13H2,1H3,(H,24,31)(H2,26,27,28,29) |
| InChIKey | FCLOIQHNUARDSR-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)NC3=CC=C(C=C3)N4CCNCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |