For research use only. Not for therapeutic Use.
CTB (Cat No.:I044526) is the non-toxic binding component of cholera toxin produced by Vibrio cholerae. It binds specifically to GM1 ganglioside receptors on the surface of mammalian cells, facilitating the entry of the A subunit in the native toxin. CTB is widely used as a molecular tool in cell biology and neuroscience for retrograde neuronal tracing, membrane trafficking studies, and immune modulation. It also serves as a mucosal vaccine adjuvant due to its ability to stimulate immune responses. CTB is non-toxic and highly effective for targeted delivery and labeling applications.
| CAS Number | 451491-47-7 |
| Synonyms | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-ethoxybenzamide |
| Molecular Formula | C16H13ClF3NO2 |
| Purity | ≥95% |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-ethoxybenzamide |
| InChI | InChI=1S/C16H13ClF3NO2/c1-2-23-14-6-4-3-5-11(14)15(22)21-10-7-8-13(17)12(9-10)16(18,19)20/h3-9H,2H2,1H3,(H,21,22) |
| InChIKey | YDXZSNHARVUYNM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)Cl)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
