For research use only. Not for therapeutic Use.
Crenulatin（Cat No.:I044856）is a naturally occurring diarylheptanoid compound primarily isolated from Alnus species, such as Alnus crenulata. It features a heptane backbone with two aromatic rings, characteristic of this bioactive class. Crenulatin exhibits notable antioxidant, anti-inflammatory, and antimicrobial activities, contributing to its traditional use in herbal medicine. It has been studied for its potential to scavenge free radicals and inhibit inflammatory pathways, making it relevant in the prevention of oxidative stress-related diseases. Its structural uniqueness also makes it a subject of interest in natural product chemistry and pharmacological research.
| CAS Number | 63026-02-8 |
| Synonyms | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-methylbut-3-en-2-yloxy)oxane-3,4,5-triol |
| Molecular Formula | C11H20O6 |
| Purity | ≥95% |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-methylbut-3-en-2-yloxy)oxane-3,4,5-triol |
| InChI | InChI=1S/C11H20O6/c1-4-11(2,3)17-10-9(15)8(14)7(13)6(5-12)16-10/h4,6-10,12-15H,1,5H2,2-3H3/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | ZEGGZNOPAPRAIG-SPFKKGSWSA-N |
| SMILES | CC(C)(C=C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
