For research use only. Not for therapeutic Use.
Creatine-d3(Cat No.:I041509)is a deuterated form of creatine, a naturally occurring compound in muscle cells that helps supply energy during high-intensity exercise. In creatine-d3, three hydrogen atoms in the molecular structure are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling allows for more accurate tracking of creatine metabolism in scientific studies, especially in areas such as muscle physiology, biochemistry, and pharmacology. By using creatine-d3 in research, scientists can better understand its absorption, distribution, and conversion processes in the body, providing valuable insights into its effects.
| CAS Number | 143827-19-4 |
| Synonyms | 2-[carbamimidoyl(trideuteriomethyl)amino]acetic acid |
| Molecular Formula | C4H6D3N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-[carbamimidoyl(trideuteriomethyl)amino]acetic acid |
| InChI | InChI=1S/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9)/i1D3 |
| InChIKey | CVSVTCORWBXHQV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(=O)O)C(=N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |