For research use only. Not for therapeutic Use.
CP-91149(Cat No.:R052583)is a selective and potent inhibitor of glycogen phosphorylase (GP), the enzyme responsible for glycogen breakdown into glucose-1-phosphate. By blocking GP activity, CP-91149 reduces hepatic glucose output, making it a valuable tool in metabolic disease research, particularly type 2 diabetes and metabolic syndrome. Preclinical studies highlight its role in regulating glucose homeostasis and improving insulin sensitivity. Beyond metabolic research, CP-91149 is also employed to explore glycogen metabolism in muscle and brain tissues, offering insights into energy regulation and therapeutic strategies targeting glycogen-associated disorders.
CAS Number | 186392-40-5 |
Synonyms | 5-chloro-N-[(2S,3R)-4-(dimethylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide |
Molecular Formula | C21H22ClN3O3 |
Purity | ≥95% |
IUPAC Name | 5-chloro-N-[(2S,3R)-4-(dimethylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide |
InChI | InChI=1S/C21H22ClN3O3/c1-25(2)21(28)19(26)17(10-13-6-4-3-5-7-13)24-20(27)18-12-14-11-15(22)8-9-16(14)23-18/h3-9,11-12,17,19,23,26H,10H2,1-2H3,(H,24,27)/t17-,19+/m0/s1 |
InChIKey | HINJNZFCMLSBCI-PKOBYXMFSA-N |
SMILES | 5-chloro-N-[(2S,3R)-4-(dimethylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |