For research use only. Not for therapeutic Use.
Coumberone（Cat No.:I044992）is a synthetic fluorescent dye belonging to the coumarin family, characterized by its strong blue fluorescence and high photostability. It is commonly used in biochemical assays, fluorescence imaging, and sensor development due to its ability to act as a fluorogenic or chromogenic probe. Coumberone’s unique structural features enable tunable photophysical properties, making it suitable for use in environmental sensing, protein labeling, and real-time cellular imaging. Its high quantum yield and low background signal enhance detection sensitivity. Coumberone is supplied at high purity for research use in chemical biology and analytical applications.
| CAS Number | 878019-47-7 |
| Synonyms | 6-benzoyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| Molecular Formula | C22H19NO3 |
| Purity | ≥95% |
| IUPAC Name | 6-benzoyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| InChI | InChI=1S/C22H19NO3/c24-19-13-17(21(25)14-6-2-1-3-7-14)18-12-15-8-4-10-23-11-5-9-16(20(15)23)22(18)26-19/h1-3,6-7,12-13H,4-5,8-11H2 |
| InChIKey | DGJJSADMDWUKOJ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C4=C2N(C1)CCC4)OC(=O)C=C3C(=O)C5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
