For research use only. Not for therapeutic Use.
Coumberol（Cat No.:I044991）is a naturally occurring coumarin derivative known for its fluorescent properties and potential biological activity. Structurally related to coumarins, it exhibits strong UV absorbance and moderate fluorescence, making it useful in spectroscopic studies and as a scaffold for fluorogenic probe development. Coumberol has been investigated for its potential antioxidant, antimicrobial, and enzyme-inhibitory effects, particularly in natural product and pharmacological research. Its planar aromatic structure facilitates interactions with biological targets.
| CAS Number | 878019-53-5 |
| Synonyms | 6-[hydroxy(phenyl)methyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| Molecular Formula | C22H21NO3 |
| Purity | ≥95% |
| IUPAC Name | 6-[hydroxy(phenyl)methyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| InChI | InChI=1S/C22H21NO3/c24-19-13-17(21(25)14-6-2-1-3-7-14)18-12-15-8-4-10-23-11-5-9-16(20(15)23)22(18)26-19/h1-3,6-7,12-13,21,25H,4-5,8-11H2 |
| InChIKey | FXBJCIJXXOXALP-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C4=C2N(C1)CCC4)OC(=O)C=C3C(C5=CC=CC=C5)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
