For research use only. Not for therapeutic Use.
Cosan-528（Cat No.:I006192） is a bioactive chemical with potential therapeutic applications. It exhibits favorable pharmacological properties and has shown promising activity in preclinical studies. Cosan-528 is believed to interact with specific molecular targets, modulating their function and signaling pathways. Its precise mechanism of action is currently under investigation. Preliminary data suggest that Cosan-528 may possess therapeutic effects in various disease conditions, making it a subject of interest for further research and development.
| CAS Number | 96686-51-0 |
| Synonyms | Cosan-528; Cosan 528; Cosan528.;2-Chloro-N-(2-methyl-4-bromophenyl)acetamide |
| Molecular Formula | C9H9BrClNO |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term ,or -20 °C for long term |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-chloroacetamide |
| InChI | InChI=1S/C9H9BrClNO/c1-6-4-7(10)2-3-8(6)12-9(13)5-11/h2-4H,5H2,1H3,(H,12,13) |
| InChIKey | AKNLFHJQVCPHHO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)NC(=O)CCl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
