For research use only. Not for therapeutic Use.
Corytuberine Methiodide(Cat No.:R049070)is a potent alkaloid compound primarily used in pharmacological research to study its effects on various biological systems. As a quaternary ammonium salt of corytuberine, it is known for its anticholinergic properties, which make it a valuable tool for exploring neurochemical pathways and receptor interactions. This compound is commonly employed in studies investigating the modulation of neurotransmitter systems, particularly those involving acetylcholine. Corytuberine Methiodide also shows promise in exploring therapeutic applications related to neurodegenerative diseases and other disorders involving cholinergic dysfunction.
| CAS Number | 4277-43-4 |
| Synonyms | (6aS)-5,6,6a,7-Tetrahydro-1,11-dihydroxy-2,10-dimethoxy-6,6-dimethyl-4H-dibenzo[de,g]quinolinium Iodide; 1,11-Dihydroxy-2,10-dimethoxy-6-methyl-6aα-aporphinium Iodide; Magnoflorine Iodide (6CI,7CI); (+)-Magnoflorine Iodide; Escholine Iodide; NSC 1504 |
| Molecular Formula | C20H24INO4 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | Store at -20°C |
| Related CAS | 2141-09-5 |
| IUPAC Name | (6aS)-2,10-dimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1,11-diol;iodide |
| InChI | InChI=1S/C20H23NO4.HI/c1-21(2)8-7-12-10-15(25-4)20(23)18-16(12)13(21)9-11-5-6-14(24-3)19(22)17(11)18;/h5-6,10,13H,7-9H2,1-4H3,(H-,22,23);1H/t13-;/m0./s1 |
| InChIKey | ODRHNGNRVVELAJ-ZOWNYOTGSA-N |
| SMILES | C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)O)OC)C.[I-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |