For research use only. Not for therapeutic Use.
Corilagin(Cat No.:R007047)is a natural ellagitannin derived from various medicinal plants, renowned for its diverse pharmacological activities. It exhibits potent antioxidant, anti-inflammatory, antiviral, and antitumor properties, making it a valuable compound in pharmaceutical research. Corilagin acts by modulating oxidative stress and inflammatory pathways, offering therapeutic potential in chronic diseases such as cancer, cardiovascular disorders, and viral infections. Additionally, its ability to inhibit specific enzymes and signaling pathways underlines its role in disease management. Corilagin is widely studied for its natural origin and potential applications in drug discovery and development.
| CAS Number | 23094-69-1 |
| Synonyms | 1-O-Galloyl-3,6-hexahydroxydiphenol-β-D-Glucopyranose; |
| Molecular Formula | C27H22O18 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | [(1S,19R,21S,22R,23R)-6,7,8,11,12,13,22,23-octahydroxy-3,16-dioxo-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-21-yl] 3,4,5-trihydroxybenzoate |
| InChI | InChI=1S/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)23-19(35)13(43-27)5-42-25(40)7-3-11(30)17(33)20(36)14(7)15-8(26(41)44-23)4-12(31)18(34)21(15)37/h1-4,13,19,22-23,27-38H,5H2/t13-,19-,22-,23+,27+/m1/s1 |
| InChIKey | TUSDEZXZIZRFGC-XIGLUPEJSA-N |
| SMILES | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |