For research use only. Not for therapeutic Use.
COQ7-IN-2（Cat No.:I044629）is a potent small-molecule inhibitor targeting COQ7, a mitochondrial hydroxylase essential for coenzyme Q (CoQ, ubiquinone) biosynthesis. By selectively inhibiting COQ7, this compound disrupts the final steps in the CoQ pathway, impairing mitochondrial electron transport and ATP production. COQ7-IN-2 is a valuable tool for studying mitochondrial metabolism, oxidative phosphorylation, and CoQ-related disorders. It also aids in exploring the therapeutic potential of targeting mitochondrial dysfunction in diseases such as cancer, neurodegeneration, and metabolic syndromes. Ideal for mechanistic studies and mitochondrial biology research.
| CAS Number | 2579696-76-5 |
| Synonyms | 2-(5-methylpyridin-2-yl)-5-phenyl-1H-pyrazol-3-one |
| Molecular Formula | C15H13N3O |
| Purity | ≥95% |
| IUPAC Name | 2-(5-methylpyridin-2-yl)-5-phenyl-1H-pyrazol-3-one |
| InChI | InChI=1S/C15H13N3O/c1-11-7-8-14(16-10-11)18-15(19)9-13(17-18)12-5-3-2-4-6-12/h2-10,17H,1H3 |
| InChIKey | SKJOGGJAXXEJKE-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)N2C(=O)C=C(N2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
